About CID 175729762
CID 175729762 (PubChem CID 175729762) has the molecular formula C3H10N2OSn
and a molecular weight of 208.84 g/mol.
Molecular Properties
| Compound Name | CID 175729762 |
| PubChem CID | 175729762 |
| Molecular Formula | C3H10N2OSn |
| Molecular Weight | 208.84 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | — |
| SMILES | NCC(O)CN.[Sn] |
| InChI | InChI=1S/C3H10N2O.Sn/c4-1-3(6)2-5;/h3,6H,1-2,4-5H2; |
| InChIKey | KKHPYVOYFJDASZ-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.84 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 175729762 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175729762?
The IUPAC name of CID 175729762 (CID 175729762) is not available.
What is the SMILES notation for CID 175729762?
The canonical SMILES for CID 175729762 is NCC(O)CN.[Sn].
What is the InChIKey of CID 175729762?
The InChIKey is KKHPYVOYFJDASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N2O.Sn/c4-1-3(6)2-5;/h3,6H,1-2,4-5H2;.
What are the key properties of CID 175729762?
CID 175729762 has a molecular weight of 208.84 g/mol, XLogP of -2.12, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175729762 is sourced from PubChem (CID 175729762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).