C17H14N4O4S — CID 175730155
ethyl 10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene-4-carboxylate (PubChem CID 175730155) has the molecular formula C17H14N4O4S and a molecular weight of 370.39 g/mol. Its IUPAC name is ethyl 10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene-4-carboxylate.
| Compound Name | ethyl 10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 175730155 |
| Molecular Formula | C17H14N4O4S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | ethyl 10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1nc2c(cnc3c2ccn3S(=O)(=O)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C17H14N4O4S/c1-2-25-17(22)15-19-13-10-18-16-12(14(13)20-15)8-9-21(16)26(23,24)11-6-4-3-5-7-11/h3-10H,2H2,1H3,(H,19,20) |
| InChIKey | PDKBTGOXZUODHK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |