C17H19N3 — CID 175730267
2-[2-(1H-indazol-4-yl)phenyl]-N,N-dimethylethanamine (PubChem CID 175730267) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[2-(1H-indazol-4-yl)phenyl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(1H-indazol-4-yl)phenyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 175730267 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-[2-(1H-indazol-4-yl)phenyl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1ccccc1-c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C17H19N3/c1-20(2)11-10-13-6-3-4-7-14(13)15-8-5-9-17-16(15)12-18-19-17/h3-9,12H,10-11H2,1-2H3,(H,18,19) |
| InChIKey | JLULZAQATIBPGG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |