C16H10F2O2S — CID 175730684
6,7-difluoro-13-oxa-10-thiatetracyclo[9.7.0.03,8.012,16]octadeca-1(11),3(8),4,6,12(16),17-hexaen-2-one (PubChem CID 175730684) has the molecular formula C16H10F2O2S and a molecular weight of 304.32 g/mol. Its IUPAC name is 6,7-difluoro-13-oxa-10-thiatetracyclo[9.7.0.03,8.012,16]octadeca-1(11),3(8),4,6,12(16),17-hexaen-2-one.
| Compound Name | 6,7-difluoro-13-oxa-10-thiatetracyclo[9.7.0.03,8.012,16]octadeca-1(11),3(8),4,6,12(16),17-hexaen-2-one |
|---|---|
| PubChem CID | 175730684 |
| Molecular Formula | C16H10F2O2S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 6,7-difluoro-13-oxa-10-thiatetracyclo[9.7.0.03,8.012,16]octadeca-1(11),3(8),4,6,12(16),17-hexaen-2-one |
| SMILES | O=C1c2ccc(F)c(F)c2CSc2c1ccc1c2OCC1 |
| InChI | InChI=1S/C16H10F2O2S/c17-12-4-3-9-11(13(12)18)7-21-16-10(14(9)19)2-1-8-5-6-20-15(8)16/h1-4H,5-7H2 |
| InChIKey | YZOSMPRHHZMKHC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |