About butanediamide;prop-2-enoic acid
butanediamide;prop-2-enoic acid (PubChem CID 175731434) has the molecular formula C7H12N2O4
and a molecular weight of 188.18 g/mol. Its IUPAC name is butanediamide;prop-2-enoic acid.
Molecular Properties
| Compound Name | butanediamide;prop-2-enoic acid |
| PubChem CID | 175731434 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | butanediamide;prop-2-enoic acid |
| SMILES | C=CC(=O)O.NC(=O)CCC(N)=O |
| InChI | InChI=1S/C4H8N2O2.C3H4O2/c5-3(7)1-2-4(6)8;1-2-3(4)5/h1-2H2,(H2,5,7)(H2,6,8);2H,1H2,(H,4,5) |
| InChIKey | YHIKTKDWTPUBKG-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butanediamide;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanediamide;prop-2-enoic acid?
The IUPAC name of butanediamide;prop-2-enoic acid (CID 175731434) is butanediamide;prop-2-enoic acid.
What is the SMILES notation for butanediamide;prop-2-enoic acid?
The canonical SMILES for butanediamide;prop-2-enoic acid is C=CC(=O)O.NC(=O)CCC(N)=O.
What is the InChIKey of butanediamide;prop-2-enoic acid?
The InChIKey is YHIKTKDWTPUBKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2.C3H4O2/c5-3(7)1-2-4(6)8;1-2-3(4)5/h1-2H2,(H2,5,7)(H2,6,8);2H,1H2,(H,4,5).
What are the key properties of butanediamide;prop-2-enoic acid?
butanediamide;prop-2-enoic acid has a molecular weight of 188.18 g/mol, XLogP of -1.01, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanediamide;prop-2-enoic acid is sourced from PubChem (CID 175731434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).