About N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine
N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine (PubChem CID 175731651) has the molecular formula C19H17N
and a molecular weight of 259.35 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine |
| PubChem CID | 175731651 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine |
| SMILES | C1=CC(N=C(c2ccccc2)c2ccccc2)=CCC1 |
| InChI | InChI=1S/C19H17N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18/h1-2,4-8,10-15H,3,9H2 |
| InChIKey | ILCAOQCSQVMKQV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine (CID 175731651) is N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine is C1=CC(N=C(c2ccccc2)c2ccccc2)=CCC1.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine?
The InChIKey is ILCAOQCSQVMKQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18/h1-2,4-8,10-15H,3,9H2.
What are the key properties of N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine?
N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine has a molecular weight of 259.35 g/mol, XLogP of 4.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-1,1-diphenylmethanimine is sourced from PubChem (CID 175731651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).