About 2-hydroxybenzoic acid;thiophen-2-amine
2-hydroxybenzoic acid;thiophen-2-amine (PubChem CID 175731664) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;thiophen-2-amine.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;thiophen-2-amine |
| PubChem CID | 175731664 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-hydroxybenzoic acid;thiophen-2-amine |
| SMILES | Nc1cccs1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C4H5NS/c8-6-4-2-1-3-5(6)7(9)10;5-4-2-1-3-6-4/h1-4,8H,(H,9,10);1-3H,5H2 |
| InChIKey | QIHAUHDHBHPYAD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxybenzoic acid;thiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;thiophen-2-amine?
The IUPAC name of 2-hydroxybenzoic acid;thiophen-2-amine (CID 175731664) is 2-hydroxybenzoic acid;thiophen-2-amine.
What is the SMILES notation for 2-hydroxybenzoic acid;thiophen-2-amine?
The canonical SMILES for 2-hydroxybenzoic acid;thiophen-2-amine is Nc1cccs1.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;thiophen-2-amine?
The InChIKey is QIHAUHDHBHPYAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C4H5NS/c8-6-4-2-1-3-5(6)7(9)10;5-4-2-1-3-6-4/h1-4,8H,(H,9,10);1-3H,5H2.
What are the key properties of 2-hydroxybenzoic acid;thiophen-2-amine?
2-hydroxybenzoic acid;thiophen-2-amine has a molecular weight of 237.28 g/mol, XLogP of 2.42, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;thiophen-2-amine is sourced from PubChem (CID 175731664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).