C16H23BF2O2 — CID 175732026
2-[6-[1-(difluoromethyl)cyclopropyl]cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 175732026) has the molecular formula C16H23BF2O2 and a molecular weight of 296.17 g/mol. Its IUPAC name is 2-[6-[1-(difluoromethyl)cyclopropyl]cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[6-[1-(difluoromethyl)cyclopropyl]cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 175732026 |
| Molecular Formula | C16H23BF2O2 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[6-[1-(difluoromethyl)cyclopropyl]cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CC=CCC2C2(C(F)F)CC2)OC1(C)C |
| InChI | InChI=1S/C16H23BF2O2/c1-14(2)15(3,4)21-17(20-14)12-8-6-5-7-11(12)16(9-10-16)13(18)19/h5-6,8,11,13H,7,9-10H2,1-4H3 |
| InChIKey | SIUZBVDCAWMSKF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|