C21H17ClF3N3O3 — CID 175732167
(15R)-8-(4-chlorophenyl)-1,6,11-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2(7),3,5,8-tetraen-10-one;2,2,2-trifluoroacetic acid (PubChem CID 175732167) has the molecular formula C21H17ClF3N3O3 and a molecular weight of 451.83 g/mol. Its IUPAC name is (15R)-8-(4-chlorophenyl)-1,6,11-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2(7),3,5,8-tetraen-10-one;2,2,2-trifluoroacetic acid.
| Compound Name | (15R)-8-(4-chlorophenyl)-1,6,11-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2(7),3,5,8-tetraen-10-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175732167 |
| Molecular Formula | C21H17ClF3N3O3 |
| Molecular Weight | 451.83 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | (15R)-8-(4-chlorophenyl)-1,6,11-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2(7),3,5,8-tetraen-10-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1c2c(-c3ccc(Cl)cc3)c3ncccc3n2C[C@H]2CCCN12 |
| InChI | InChI=1S/C19H16ClN3O.C2HF3O2/c20-13-7-5-12(6-8-13)16-17-15(4-1-9-21-17)23-11-14-3-2-10-22(14)19(24)18(16)23;3-2(4,5)1(6)7/h1,4-9,14H,2-3,10-11H2;(H,6,7)/t14-;/m1./s1 |
| InChIKey | ZYJJUTISSBXWTI-PFEQFJNWSA-N |
| XLogP | 4.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |