About tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate
tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate (PubChem CID 175732852) has the molecular formula C30H58N6O4
and a molecular weight of 566.83 g/mol. Its IUPAC name is tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| PubChem CID | 175732852 |
| Molecular Formula | C30H58N6O4 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.45 |
| IUPAC Name | tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCN(CCCN)CC2)C1.CC(C)(C)OC(=O)N1CC2(CCN(CCCN)CC2)C1 |
| InChI | InChI=1S/2C15H29N3O2/c2*1-14(2,3)20-13(19)18-11-15(12-18)5-9-17(10-6-15)8-4-7-16/h2*4-12,16H2,1-3H3 |
| InChIKey | VBUAESMUGPERII-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 117.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate?
The IUPAC name of tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate (CID 175732852) is tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate.
What is the SMILES notation for tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate?
The canonical SMILES for tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate is CC(C)(C)OC(=O)N1CC2(CCN(CCCN)CC2)C1.CC(C)(C)OC(=O)N1CC2(CCN(CCCN)CC2)C1.
What is the InChIKey of tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate?
The InChIKey is VBUAESMUGPERII-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H29N3O2/c2*1-14(2,3)20-13(19)18-11-15(12-18)5-9-17(10-6-15)8-4-7-16/h2*4-12,16H2,1-3H3.
What are the key properties of tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate?
tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate has a molecular weight of 566.83 g/mol, XLogP of 3.34, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-(3-aminopropyl)-2,7-diazaspiro[3.5]nonane-2-carboxylate is sourced from PubChem (CID 175732852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).