C18H30O4 — CID 175733301
[(2E)-3,7-dimethylocta-2,6-dienyl] 2-(4-ethyl-2-methyl-1,3-dioxolan-2-yl)acetate (PubChem CID 175733301) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(4-ethyl-2-methyl-1,3-dioxolan-2-yl)acetate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(4-ethyl-2-methyl-1,3-dioxolan-2-yl)acetate |
|---|---|
| PubChem CID | 175733301 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(4-ethyl-2-methyl-1,3-dioxolan-2-yl)acetate |
| SMILES | CCC1COC(C)(CC(=O)OC/C=C(\C)CCC=C(C)C)O1 |
| InChI | InChI=1S/C18H30O4/c1-6-16-13-21-18(5,22-16)12-17(19)20-11-10-15(4)9-7-8-14(2)3/h8,10,16H,6-7,9,11-13H2,1-5H3/b15-10+ |
| InChIKey | AVJTUROOXGOKIS-XNTDXEJSSA-N |
| XLogP | 4.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|