C60H57N19 — CID 175733866
1,2-bis(1-benzyltriazol-4-yl)-N,N-bis[1,2-bis(1-benzyltriazol-4-yl)ethyl]ethanamine (PubChem CID 175733866) has the molecular formula C60H57N19 and a molecular weight of 1044.25 g/mol. Its IUPAC name is 1,2-bis(1-benzyltriazol-4-yl)-N,N-bis[1,2-bis(1-benzyltriazol-4-yl)ethyl]ethanamine.
| Compound Name | 1,2-bis(1-benzyltriazol-4-yl)-N,N-bis[1,2-bis(1-benzyltriazol-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 175733866 |
| Molecular Formula | C60H57N19 |
| Molecular Weight | 1044.25 g/mol |
| Exact Mass | 1043.50 |
| IUPAC Name | 1,2-bis(1-benzyltriazol-4-yl)-N,N-bis[1,2-bis(1-benzyltriazol-4-yl)ethyl]ethanamine |
| SMILES | c1ccc(Cn2cc(CC(c3cn(Cc4ccccc4)nn3)N(C(Cc3cn(Cc4ccccc4)nn3)c3cn(Cc4ccccc4)nn3)C(Cc3cn(Cc4ccccc4)nn3)c3cn(Cc4ccccc4)nn3)nn2)cc1 |
| InChI | InChI=1S/C60H57N19/c1-7-19-46(20-8-1)34-73-40-52(61-67-73)31-58(55-43-76(70-64-55)37-49-25-13-4-14-26-49)79(59(56-44-77(71-65-56)38-50-27-15-5-16-28-50)32-53-41-74(68-62-53)35-47-21-9-2-10-22-47)60(57-45-78(72-66-57)39-51-29-17-6-18-30-51)33-54-42-75(69-63-54)36-48-23-11-3-12-24-48/h1-30,40-45,58-60H,31-39H2 |
| InChIKey | JVEBZWKOAOFRBR-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 187.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.25 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |