C22H13ClF2N4O2 — CID 175734142
3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-6-(2-phenylphenyl)-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 175734142) has the molecular formula C22H13ClF2N4O2 and a molecular weight of 438.82 g/mol. Its IUPAC name is 3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-6-(2-phenylphenyl)-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-6-(2-phenylphenyl)-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 175734142 |
| Molecular Formula | C22H13ClF2N4O2 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-6-(2-phenylphenyl)-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1c2cc(-c3noc(C(F)(F)Cl)n3)cnc2CN1c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H13ClF2N4O2/c23-22(24,25)21-27-19(28-31-21)14-10-16-17(26-11-14)12-29(20(16)30)18-9-5-4-8-15(18)13-6-2-1-3-7-13/h1-11H,12H2 |
| InChIKey | OUARSLKCPJCYGN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|