C17H16ClF3N6O2 — CID 175734843
8-(2-chlorophenyl)-9-pyrrolidin-3-ylpurin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 175734843) has the molecular formula C17H16ClF3N6O2 and a molecular weight of 428.80 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-9-pyrrolidin-3-ylpurin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(2-chlorophenyl)-9-pyrrolidin-3-ylpurin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175734843 |
| Molecular Formula | C17H16ClF3N6O2 |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 8-(2-chlorophenyl)-9-pyrrolidin-3-ylpurin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1ncc2nc(-c3ccccc3Cl)n(C3CCNC3)c2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H15ClN6.C2HF3O2/c16-11-4-2-1-3-10(11)13-20-12-8-19-15(17)21-14(12)22(13)9-5-6-18-7-9;3-2(4,5)1(6)7/h1-4,8-9,18H,5-7H2,(H2,17,19,21);(H,6,7) |
| InChIKey | PXOOEYIUAIAXIT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |