About 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide
3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide (PubChem CID 175735519) has the molecular formula C21H17ClN4O2
and a molecular weight of 392.85 g/mol. Its IUPAC name is 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide.
Molecular Properties
| Compound Name | 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide |
| PubChem CID | 175735519 |
| Molecular Formula | C21H17ClN4O2 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide |
| SMILES | N#Cc1nccc(C(N)=O)c1C1CC2(CC(c3nc4cc(Cl)ccc4o3)C2)C1 |
| InChI | InChI=1S/C21H17ClN4O2/c22-13-1-2-17-15(5-13)26-20(28-17)12-8-21(9-12)6-11(7-21)18-14(19(24)27)3-4-25-16(18)10-23/h1-5,11-12H,6-9H2,(H2,24,27) |
| InChIKey | KILANJSHHMILAR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide?
The IUPAC name of 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide (CID 175735519) is 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide.
What is the SMILES notation for 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide?
The canonical SMILES for 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide is N#Cc1nccc(C(N)=O)c1C1CC2(CC(c3nc4cc(Cl)ccc4o3)C2)C1.
What is the InChIKey of 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide?
The InChIKey is KILANJSHHMILAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN4O2/c22-13-1-2-17-15(5-13)26-20(28-17)12-8-21(9-12)6-11(7-21)18-14(19(24)27)3-4-25-16(18)10-23/h1-5,11-12H,6-9H2,(H2,24,27).
What are the key properties of 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide?
3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide has a molecular weight of 392.85 g/mol, XLogP of 4.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(5-chloro-1,3-benzoxazol-2-yl)spiro[3.3]heptan-6-yl]-2-cyanopyridine-4-carboxamide is sourced from PubChem (CID 175735519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).