C14H20O — CID 175735832
(1R,2R,4R,6S,8R,9R,11E)-11-ethylidene-4-methyl-5-oxatetracyclo[7.2.1.02,8.04,6]dodecane (PubChem CID 175735832) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (1R,2R,4R,6S,8R,9R,11E)-11-ethylidene-4-methyl-5-oxatetracyclo[7.2.1.02,8.04,6]dodecane.
| Compound Name | (1R,2R,4R,6S,8R,9R,11E)-11-ethylidene-4-methyl-5-oxatetracyclo[7.2.1.02,8.04,6]dodecane |
|---|---|
| PubChem CID | 175735832 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1R,2R,4R,6S,8R,9R,11E)-11-ethylidene-4-methyl-5-oxatetracyclo[7.2.1.02,8.04,6]dodecane |
| SMILES | C/C=C1\C[C@H]2C[C@@H]1[C@@H]1C[C@@]3(C)O[C@H]3C[C@H]21 |
| InChI | InChI=1S/C14H20O/c1-3-8-4-9-5-10(8)12-7-14(2)13(15-14)6-11(9)12/h3,9-13H,4-7H2,1-2H3/b8-3+/t9-,10-,11+,12-,13-,14+/m0/s1 |
| InChIKey | MOVCGUWIPGWQGE-ROVLQZRQSA-N |
| XLogP | 3.16 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|