About 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one
2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one (PubChem CID 175736121) has the molecular formula C8H5FO
and a molecular weight of 135.13 g/mol. Its IUPAC name is 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one.
Molecular Properties
| Compound Name | 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one |
| PubChem CID | 175736121 |
| Molecular Formula | C8H5FO |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one |
| SMILES | O=C1Cc2c([18F])cccc21 |
| InChI | InChI=1S/C8H5FO/c9-7-3-1-2-5-6(7)4-8(5)10/h1-3H,4H2/i9-1 |
| InChIKey | GQJWZZYEXMIGTJ-RVRFMXCPSA-N |
| XLogP | 1.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one?
The IUPAC name of 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one (CID 175736121) is 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one.
What is the SMILES notation for 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one?
The canonical SMILES for 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one is O=C1Cc2c([18F])cccc21.
What is the InChIKey of 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one?
The InChIKey is GQJWZZYEXMIGTJ-RVRFMXCPSA-N. The full InChI is InChI=1S/C8H5FO/c9-7-3-1-2-5-6(7)4-8(5)10/h1-3H,4H2/i9-1.
What are the key properties of 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one?
2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one has a molecular weight of 135.13 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(18F)fluorobicyclo[4.2.0]octa-1(6),2,4-trien-7-one is sourced from PubChem (CID 175736121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).