C43H54Hf — CID 175736229
[cyclobutyl-[3,5-di(propan-2-yl)phenyl]methylidene]hafnium(2+);cyclopenta-1,3-diene;2,7-ditert-butyl-9H-fluoren-9-ide (PubChem CID 175736229) has the molecular formula C43H54Hf and a molecular weight of 749.39 g/mol. Its IUPAC name is [cyclobutyl-[3,5-di(propan-2-yl)phenyl]methylidene]hafnium(2+);cyclopenta-1,3-diene;2,7-ditert-butyl-9H-fluoren-9-ide.
| Compound Name | [cyclobutyl-[3,5-di(propan-2-yl)phenyl]methylidene]hafnium(2+);cyclopenta-1,3-diene;2,7-ditert-butyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 175736229 |
| Molecular Formula | C43H54Hf |
| Molecular Weight | 749.39 g/mol |
| Exact Mass | 750.37 |
| IUPAC Name | [cyclobutyl-[3,5-di(propan-2-yl)phenyl]methylidene]hafnium(2+);cyclopenta-1,3-diene;2,7-ditert-butyl-9H-fluoren-9-ide |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1cc(C(C)(C)C)ccc12.CC(C)c1cc(C(=[Hf+2])C2CCC2)cc(C(C)C)c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C21H25.C17H24.C5H5.Hf/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-12(2)16-9-15(8-14-6-5-7-14)10-17(11-16)13(3)4;1-2-4-5-3-1;/h7-13H,1-6H3;9-14H,5-7H2,1-4H3;1-5H;/q-1;;-1;+2 |
| InChIKey | WGQAVQZBJRSWEC-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.39 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|