About zinc methyl (2R)-3-bromo-2-methylpropanoate
zinc methyl (2R)-3-bromo-2-methylpropanoate (PubChem CID 175736425) has the molecular formula C5H9BrO2Zn+2
and a molecular weight of 246.42 g/mol. Its IUPAC name is zinc methyl (2R)-3-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | zinc methyl (2R)-3-bromo-2-methylpropanoate |
| PubChem CID | 175736425 |
| Molecular Formula | C5H9BrO2Zn+2 |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 243.91 |
| IUPAC Name | zinc methyl (2R)-3-bromo-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)CBr.[Zn+2] |
| InChI | InChI=1S/C5H9BrO2.Zn/c1-4(3-6)5(7)8-2;/h4H,3H2,1-2H3;/q;+2/t4-;/m0./s1 |
| InChIKey | JZXGMFSQYSBXCR-WCCKRBBISA-N |
| XLogP | 1.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc methyl (2R)-3-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc methyl (2R)-3-bromo-2-methylpropanoate?
The IUPAC name of zinc methyl (2R)-3-bromo-2-methylpropanoate (CID 175736425) is zinc methyl (2R)-3-bromo-2-methylpropanoate.
What is the SMILES notation for zinc methyl (2R)-3-bromo-2-methylpropanoate?
The canonical SMILES for zinc methyl (2R)-3-bromo-2-methylpropanoate is COC(=O)[C@@H](C)CBr.[Zn+2].
What is the InChIKey of zinc methyl (2R)-3-bromo-2-methylpropanoate?
The InChIKey is JZXGMFSQYSBXCR-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9BrO2.Zn/c1-4(3-6)5(7)8-2;/h4H,3H2,1-2H3;/q;+2/t4-;/m0./s1.
What are the key properties of zinc methyl (2R)-3-bromo-2-methylpropanoate?
zinc methyl (2R)-3-bromo-2-methylpropanoate has a molecular weight of 246.42 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc methyl (2R)-3-bromo-2-methylpropanoate is sourced from PubChem (CID 175736425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).