C22H16BF5O4S — CID 175736436
(2,3,4,5,6-pentafluorophenoxy)boronic acid;2-propan-2-ylthioxanthen-9-one (PubChem CID 175736436) has the molecular formula C22H16BF5O4S and a molecular weight of 482.24 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)boronic acid;2-propan-2-ylthioxanthen-9-one.
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)boronic acid;2-propan-2-ylthioxanthen-9-one |
|---|---|
| PubChem CID | 175736436 |
| Molecular Formula | C22H16BF5O4S |
| Molecular Weight | 482.24 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)boronic acid;2-propan-2-ylthioxanthen-9-one |
| SMILES | CC(C)c1ccc2sc3ccccc3c(=O)c2c1.OB(O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H14OS.C6H2BF5O3/c1-10(2)11-7-8-15-13(9-11)16(17)12-5-3-4-6-14(12)18-15;8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h3-10H,1-2H3;13-14H |
| InChIKey | SEYRCZLEHZVTSU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.24 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|