C13H28OSi — CID 175737514
3,7-dimethyl-1-trimethylsilyloct-6-en-1-ol (PubChem CID 175737514) has the molecular formula C13H28OSi and a molecular weight of 228.45 g/mol. Its IUPAC name is 3,7-dimethyl-1-trimethylsilyloct-6-en-1-ol.
| Compound Name | 3,7-dimethyl-1-trimethylsilyloct-6-en-1-ol |
|---|---|
| PubChem CID | 175737514 |
| Molecular Formula | C13H28OSi |
| Molecular Weight | 228.45 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 3,7-dimethyl-1-trimethylsilyloct-6-en-1-ol |
| SMILES | CC(C)=CCCC(C)CC(O)[Si](C)(C)C |
| InChI | InChI=1S/C13H28OSi/c1-11(2)8-7-9-12(3)10-13(14)15(4,5)6/h8,12-14H,7,9-10H2,1-6H3 |
| InChIKey | ZZFQDXZGZBPFNK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|