C17H32OSi — CID 175737521
(E)-3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-trimethylsilylpent-4-en-2-ol (PubChem CID 175737521) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is (E)-3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-trimethylsilylpent-4-en-2-ol.
| Compound Name | (E)-3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-trimethylsilylpent-4-en-2-ol |
|---|---|
| PubChem CID | 175737521 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (E)-3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-trimethylsilylpent-4-en-2-ol |
| SMILES | CC1=CCC(/C=C/C(C)C(O)C[Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C17H32OSi/c1-13(16(18)12-19(5,6)7)8-10-15-11-9-14(2)17(15,3)4/h8-10,13,15-16,18H,11-12H2,1-7H3/b10-8+ |
| InChIKey | XVBZNDDUZXUYTO-CSKARUKUSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|