About 2-pyrrol-1-ylhexanamide
2-pyrrol-1-ylhexanamide (PubChem CID 175737735) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-pyrrol-1-ylhexanamide.
Molecular Properties
| Compound Name | 2-pyrrol-1-ylhexanamide |
| PubChem CID | 175737735 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-pyrrol-1-ylhexanamide |
| SMILES | CCCCC(C(N)=O)n1cccc1 |
| InChI | InChI=1S/C10H16N2O/c1-2-3-6-9(10(11)13)12-7-4-5-8-12/h4-5,7-9H,2-3,6H2,1H3,(H2,11,13) |
| InChIKey | LBFZPKVTFGRDKM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyrrol-1-ylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrol-1-ylhexanamide?
The IUPAC name of 2-pyrrol-1-ylhexanamide (CID 175737735) is 2-pyrrol-1-ylhexanamide.
What is the SMILES notation for 2-pyrrol-1-ylhexanamide?
The canonical SMILES for 2-pyrrol-1-ylhexanamide is CCCCC(C(N)=O)n1cccc1.
What is the InChIKey of 2-pyrrol-1-ylhexanamide?
The InChIKey is LBFZPKVTFGRDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-3-6-9(10(11)13)12-7-4-5-8-12/h4-5,7-9H,2-3,6H2,1H3,(H2,11,13).
What are the key properties of 2-pyrrol-1-ylhexanamide?
2-pyrrol-1-ylhexanamide has a molecular weight of 180.25 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrol-1-ylhexanamide is sourced from PubChem (CID 175737735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).