About 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol
1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol (PubChem CID 175737780) has the molecular formula C14H20Br2N2O
and a molecular weight of 393.14 g/mol. Its IUPAC name is 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol |
| PubChem CID | 175737780 |
| Molecular Formula | C14H20Br2N2O |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol |
| SMILES | [2H]CN(Cc1cc(Br)cc(Br)c1N)C1(O)CCCCC1 |
| InChI | InChI=1S/C14H20Br2N2O/c1-18(14(19)5-3-2-4-6-14)9-10-7-11(15)8-12(16)13(10)17/h7-8,19H,2-6,9,17H2,1H3/i1D |
| InChIKey | WUVNWJFQOJNTIR-MICDWDOJSA-N |
| XLogP | 3.88 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol?
The IUPAC name of 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol (CID 175737780) is 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol.
What is the SMILES notation for 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol?
The canonical SMILES for 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol is [2H]CN(Cc1cc(Br)cc(Br)c1N)C1(O)CCCCC1.
What is the InChIKey of 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol?
The InChIKey is WUVNWJFQOJNTIR-MICDWDOJSA-N. The full InChI is InChI=1S/C14H20Br2N2O/c1-18(14(19)5-3-2-4-6-14)9-10-7-11(15)8-12(16)13(10)17/h7-8,19H,2-6,9,17H2,1H3/i1D.
What are the key properties of 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol?
1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol has a molecular weight of 393.14 g/mol, XLogP of 3.88, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-amino-3,5-dibromophenyl)methyl-(deuteriomethyl)amino]cyclohexan-1-ol is sourced from PubChem (CID 175737780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).