C24H15F4N3O2 — CID 175737841
N-(2,3-dihydro-1,4-benzoxazin-4-yl)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide (PubChem CID 175737841) has the molecular formula C24H15F4N3O2 and a molecular weight of 453.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzoxazin-4-yl)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzoxazin-4-yl)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 175737841 |
| Molecular Formula | C24H15F4N3O2 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzoxazin-4-yl)-7-fluoro-8-(2,3,5-trifluorophenyl)quinoline-3-carboxamide |
| SMILES | O=C(NN1CCOc2ccccc21)c1cnc2c(-c3cc(F)cc(F)c3F)c(F)ccc2c1 |
| InChI | InChI=1S/C24H15F4N3O2/c25-15-10-16(22(28)18(27)11-15)21-17(26)6-5-13-9-14(12-29-23(13)21)24(32)30-31-7-8-33-20-4-2-1-3-19(20)31/h1-6,9-12H,7-8H2,(H,30,32) |
| InChIKey | CLDKYKXPQKOEIN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|