C9H9F11N2O3 — CID 175737917
2-fluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-4-hydroxybutoxy)propoxy]ethanimidamide (PubChem CID 175737917) has the molecular formula C9H9F11N2O3 and a molecular weight of 402.16 g/mol. Its IUPAC name is 2-fluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-4-hydroxybutoxy)propoxy]ethanimidamide.
| Compound Name | 2-fluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-4-hydroxybutoxy)propoxy]ethanimidamide |
|---|---|
| PubChem CID | 175737917 |
| Molecular Formula | C9H9F11N2O3 |
| Molecular Weight | 402.16 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 2-fluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-4-hydroxybutoxy)propoxy]ethanimidamide |
| SMILES | [H]/N=C(\N)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)CCO)C(F)(F)F |
| InChI | InChI=1S/C9H9F11N2O3/c10-3(4(21)22)24-9(19,20)6(13,7(14,15)16)25-8(17,18)5(11,12)1-2-23/h3,23H,1-2H2,(H3,21,22) |
| InChIKey | IUSFSURREACNRJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|