About 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol
2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol (PubChem CID 175738838) has the molecular formula C16H15ClO3
and a molecular weight of 290.75 g/mol. Its IUPAC name is 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol.
Molecular Properties
| Compound Name | 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol |
| PubChem CID | 175738838 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol |
| SMILES | Oc1ccccc1[C@@H]1CCO[C@H](c2ccccc2Cl)O1 |
| InChI | InChI=1S/C16H15ClO3/c17-13-7-3-1-5-11(13)16-19-10-9-15(20-16)12-6-2-4-8-14(12)18/h1-8,15-16,18H,9-10H2/t15-,16-/m0/s1 |
| InChIKey | DOMHRCULNHPDMS-HOTGVXAUSA-N |
| XLogP | 4.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol?
The IUPAC name of 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol (CID 175738838) is 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol.
What is the SMILES notation for 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol?
The canonical SMILES for 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol is Oc1ccccc1[C@@H]1CCO[C@H](c2ccccc2Cl)O1.
What is the InChIKey of 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol?
The InChIKey is DOMHRCULNHPDMS-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H15ClO3/c17-13-7-3-1-5-11(13)16-19-10-9-15(20-16)12-6-2-4-8-14(12)18/h1-8,15-16,18H,9-10H2/t15-,16-/m0/s1.
What are the key properties of 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol?
2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol has a molecular weight of 290.75 g/mol, XLogP of 4.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4S)-2-(2-chlorophenyl)-1,3-dioxan-4-yl]phenol is sourced from PubChem (CID 175738838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).