C70H46O8 — CID 175738927
3-[2-[4-[2-(2,3-dicarboxy-4,5,6-triphenylphenyl)phenyl]phenyl]phenyl]-4,5,6-triphenylphthalic acid (PubChem CID 175738927) has the molecular formula C70H46O8 and a molecular weight of 1015.13 g/mol. Its IUPAC name is 3-[2-[4-[2-(2,3-dicarboxy-4,5,6-triphenylphenyl)phenyl]phenyl]phenyl]-4,5,6-triphenylphthalic acid.
| Compound Name | 3-[2-[4-[2-(2,3-dicarboxy-4,5,6-triphenylphenyl)phenyl]phenyl]phenyl]-4,5,6-triphenylphthalic acid |
|---|---|
| PubChem CID | 175738927 |
| Molecular Formula | C70H46O8 |
| Molecular Weight | 1015.13 g/mol |
| Exact Mass | 1014.32 |
| IUPAC Name | 3-[2-[4-[2-(2,3-dicarboxy-4,5,6-triphenylphenyl)phenyl]phenyl]phenyl]-4,5,6-triphenylphthalic acid |
| SMILES | O=C(O)c1c(C(=O)O)c(-c2ccccc2-c2ccc(-c3ccccc3-c3c(C(=O)O)c(C(=O)O)c(-c4ccccc4)c(-c4ccccc4)c3-c3ccccc3)cc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C70H46O8/c71-67(72)63-59(49-31-15-5-16-32-49)55(45-23-7-1-8-24-45)57(47-27-11-3-12-28-47)61(65(63)69(75)76)53-37-21-19-35-51(53)43-39-41-44(42-40-43)52-36-20-22-38-54(52)62-58(48-29-13-4-14-30-48)56(46-25-9-2-10-26-46)60(50-33-17-6-18-34-50)64(68(73)74)66(62)70(77)78/h1-42H,(H,71,72)(H,73,74)(H,75,76)(H,77,78) |
| InChIKey | UJJZINFJMTVPOM-UHFFFAOYSA-N |
| XLogP | 17.15 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.13 |
| LogP ≤ 5 | 17.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |