C27H40N4O5 — CID 175739260
2-[[(2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-cyclopropylpropanoyl]amino]hexanoyl piperidine-4-carboxylate (PubChem CID 175739260) has the molecular formula C27H40N4O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is 2-[[(2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-cyclopropylpropanoyl]amino]hexanoyl piperidine-4-carboxylate.
| Compound Name | 2-[[(2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-cyclopropylpropanoyl]amino]hexanoyl piperidine-4-carboxylate |
|---|---|
| PubChem CID | 175739260 |
| Molecular Formula | C27H40N4O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 2-[[(2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-cyclopropylpropanoyl]amino]hexanoyl piperidine-4-carboxylate |
| SMILES | CCCCC(NC(=O)[C@@H](CC1CC1)NC(=O)[C@H](N)Cc1ccccc1)C(=O)OC(=O)C1CCNCC1 |
| InChI | InChI=1S/C27H40N4O5/c1-2-3-9-22(27(35)36-26(34)20-12-14-29-15-13-20)30-25(33)23(17-19-10-11-19)31-24(32)21(28)16-18-7-5-4-6-8-18/h4-8,19-23,29H,2-3,9-17,28H2,1H3,(H,30,33)(H,31,32)/t21-,22?,23-/m1/s1 |
| InChIKey | NPKDINSBAJUJNR-OJVMETQDSA-N |
| XLogP | 1.59 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|