C16H19FLiN2O4 — CID 175739360
CID 175739360 (PubChem CID 175739360) has the molecular formula C16H19FLiN2O4 and a molecular weight of 329.28 g/mol.
| Compound Name | CID 175739360 |
|---|---|
| PubChem CID | 175739360 |
| Molecular Formula | C16H19FLiN2O4 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | — |
| SMILES | CC(C)Oc1c(C(=O)O)cn2cc(C3CCOCC3)nc2c1F.[Li] |
| InChI | InChI=1S/C16H19FN2O4.Li/c1-9(2)23-14-11(16(20)21)7-19-8-12(18-15(19)13(14)17)10-3-5-22-6-4-10;/h7-10H,3-6H2,1-2H3,(H,20,21); |
| InChIKey | HQHZSPYDVZVYOS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |