C17H20N6O3 — CID 175739698
formic acid;4-N-[[(2S)-oxolan-2-yl]methyl]-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine (PubChem CID 175739698) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is formic acid;4-N-[[(2S)-oxolan-2-yl]methyl]-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine.
| Compound Name | formic acid;4-N-[[(2S)-oxolan-2-yl]methyl]-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 175739698 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | formic acid;4-N-[[(2S)-oxolan-2-yl]methyl]-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine |
| SMILES | Nc1nc(NC[C@@H]2CCCO2)c2ccc(-c3ccn[nH]3)cc2n1.O=CO |
| InChI | InChI=1S/C16H18N6O.CH2O2/c17-16-20-14-8-10(13-5-6-19-22-13)3-4-12(14)15(21-16)18-9-11-2-1-7-23-11;2-1-3/h3-6,8,11H,1-2,7,9H2,(H,19,22)(H3,17,18,20,21);1H,(H,2,3)/t11-;/m0./s1 |
| InChIKey | XTZYVDMBYYFTNY-MERQFXBCSA-N |
| XLogP | 1.89 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|