C13H20N4 — CID 175740276
4-(7-azaspiro[3.5]nonan-7-yl)pyridine-2,3-diamine (PubChem CID 175740276) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-(7-azaspiro[3.5]nonan-7-yl)pyridine-2,3-diamine.
| Compound Name | 4-(7-azaspiro[3.5]nonan-7-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 175740276 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4-(7-azaspiro[3.5]nonan-7-yl)pyridine-2,3-diamine |
| SMILES | Nc1nccc(N2CCC3(CCC3)CC2)c1N |
| InChI | InChI=1S/C13H20N4/c14-11-10(2-7-16-12(11)15)17-8-5-13(6-9-17)3-1-4-13/h2,7H,1,3-6,8-9,14H2,(H2,15,16) |
| InChIKey | SPGFSOFXFBAPGO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |