About N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide
N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide (PubChem CID 175740422) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide |
| PubChem CID | 175740422 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide |
| SMILES | CCC1OCC(NC(C)=O)C(C)C1C |
| InChI | InChI=1S/C11H21NO2/c1-5-11-8(3)7(2)10(6-14-11)12-9(4)13/h7-8,10-11H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | DPKRWRCFMHRKNZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide?
The IUPAC name of N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide (CID 175740422) is N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide.
What is the SMILES notation for N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide?
The canonical SMILES for N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide is CCC1OCC(NC(C)=O)C(C)C1C.
What is the InChIKey of N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide?
The InChIKey is DPKRWRCFMHRKNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-5-11-8(3)7(2)10(6-14-11)12-9(4)13/h7-8,10-11H,5-6H2,1-4H3,(H,12,13).
What are the key properties of N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide?
N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide has a molecular weight of 199.29 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-ethyl-4,5-dimethyloxan-3-yl)acetamide is sourced from PubChem (CID 175740422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).