C26H32N6O2 — CID 175740477
4,6-bis[6-(butylamino)-2-pyridinyl]benzene-1,3-dicarboxamide (PubChem CID 175740477) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4,6-bis[6-(butylamino)-2-pyridinyl]benzene-1,3-dicarboxamide.
| Compound Name | 4,6-bis[6-(butylamino)-2-pyridinyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 175740477 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 4,6-bis[6-(butylamino)-2-pyridinyl]benzene-1,3-dicarboxamide |
| SMILES | CCCCNc1cccc(-c2cc(-c3cccc(NCCCC)n3)c(C(N)=O)cc2C(N)=O)n1 |
| InChI | InChI=1S/C26H32N6O2/c1-3-5-13-29-23-11-7-9-21(31-23)17-15-18(20(26(28)34)16-19(17)25(27)33)22-10-8-12-24(32-22)30-14-6-4-2/h7-12,15-16H,3-6,13-14H2,1-2H3,(H2,27,33)(H2,28,34)(H,29,31)(H,30,32) |
| InChIKey | CNPWXZOZUJENFS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|