C14H21F2NO3SSi — CID 175740928
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,2-difluorocyclopropyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 175740928) has the molecular formula C14H21F2NO3SSi and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,2-difluorocyclopropyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,2-difluorocyclopropyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 175740928 |
| Molecular Formula | C14H21F2NO3SSi |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,2-difluorocyclopropyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nc(C2CC2(F)F)sc1C(=O)O |
| InChI | InChI=1S/C14H21F2NO3SSi/c1-13(2,3)22(4,5)20-7-9-10(12(18)19)21-11(17-9)8-6-14(8,15)16/h8H,6-7H2,1-5H3,(H,18,19) |
| InChIKey | GCQTUFVKIMVZNP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|