C29H32Hf-2 — CID 175741009
8-benzyl-2,3,6,7-tetrahydro-1H-as-indacen-7-ide;hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 175741009) has the molecular formula C29H32Hf-2 and a molecular weight of 559.07 g/mol. Its IUPAC name is 8-benzyl-2,3,6,7-tetrahydro-1H-as-indacen-7-ide;hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | 8-benzyl-2,3,6,7-tetrahydro-1H-as-indacen-7-ide;hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 175741009 |
| Molecular Formula | C29H32Hf-2 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 8-benzyl-2,3,6,7-tetrahydro-1H-as-indacen-7-ide;hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[C-]1=C(Cc2ccccc2)c2c(ccc3c2CCC3)C1.[Hf] |
| InChI | InChI=1S/C19H17.C10H15.Hf/c1-2-5-14(6-3-1)13-17-12-11-16-10-9-15-7-4-8-18(15)19(16)17;1-6-7(2)9(4)10(5)8(6)3;/h1-3,5-6,9-10H,4,7-8,11,13H2;1-5H3;/q2*-1; |
| InChIKey | VOPRPVWLOWRABV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|