C28H34Hf-2 — CID 175741056
hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;3-pentyl-1,2-dihydrocyclopenta[b]naphthalen-2-ide (PubChem CID 175741056) has the molecular formula C28H34Hf-2 and a molecular weight of 549.07 g/mol. Its IUPAC name is hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;3-pentyl-1,2-dihydrocyclopenta[b]naphthalen-2-ide.
| Compound Name | hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;3-pentyl-1,2-dihydrocyclopenta[b]naphthalen-2-ide |
|---|---|
| PubChem CID | 175741056 |
| Molecular Formula | C28H34Hf-2 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;3-pentyl-1,2-dihydrocyclopenta[b]naphthalen-2-ide |
| SMILES | CCCCCC1=[C-]Cc2cc3ccccc3cc21.Cc1c(C)c(C)[c-](C)c1C.[Hf] |
| InChI | InChI=1S/C18H19.C10H15.Hf/c1-2-3-4-7-14-10-11-17-12-15-8-5-6-9-16(15)13-18(14)17;1-6-7(2)9(4)10(5)8(6)3;/h5-6,8-9,12-13H,2-4,7,11H2,1H3;1-5H3;/q2*-1; |
| InChIKey | MSGALVGSYUFNAI-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|