About 1,2-dichloro-5-phenylcyclohexa-1,3-diene
1,2-dichloro-5-phenylcyclohexa-1,3-diene (PubChem CID 175741102) has the molecular formula C12H10Cl2
and a molecular weight of 225.12 g/mol. Its IUPAC name is 1,2-dichloro-5-phenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1,2-dichloro-5-phenylcyclohexa-1,3-diene |
| PubChem CID | 175741102 |
| Molecular Formula | C12H10Cl2 |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 1,2-dichloro-5-phenylcyclohexa-1,3-diene |
| SMILES | ClC1=C(Cl)CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C12H10Cl2/c13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9/h1-7,10H,8H2 |
| InChIKey | YROKOSQDGUEPIT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dichloro-5-phenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-5-phenylcyclohexa-1,3-diene?
The IUPAC name of 1,2-dichloro-5-phenylcyclohexa-1,3-diene (CID 175741102) is 1,2-dichloro-5-phenylcyclohexa-1,3-diene.
What is the SMILES notation for 1,2-dichloro-5-phenylcyclohexa-1,3-diene?
The canonical SMILES for 1,2-dichloro-5-phenylcyclohexa-1,3-diene is ClC1=C(Cl)CC(c2ccccc2)C=C1.
What is the InChIKey of 1,2-dichloro-5-phenylcyclohexa-1,3-diene?
The InChIKey is YROKOSQDGUEPIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2/c13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9/h1-7,10H,8H2.
What are the key properties of 1,2-dichloro-5-phenylcyclohexa-1,3-diene?
1,2-dichloro-5-phenylcyclohexa-1,3-diene has a molecular weight of 225.12 g/mol, XLogP of 4.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-5-phenylcyclohexa-1,3-diene is sourced from PubChem (CID 175741102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).