C26H23F6N5O5 — CID 175741258
(12R)-21-nitro-6-phenylmethoxy-6,19-bis(trifluoromethyl)-14,23-dioxa-3,4,17,22-tetrazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,18(22),19-hexaene (PubChem CID 175741258) has the molecular formula C26H23F6N5O5 and a molecular weight of 599.49 g/mol. Its IUPAC name is (12R)-21-nitro-6-phenylmethoxy-6,19-bis(trifluoromethyl)-14,23-dioxa-3,4,17,22-tetrazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,18(22),19-hexaene.
| Compound Name | (12R)-21-nitro-6-phenylmethoxy-6,19-bis(trifluoromethyl)-14,23-dioxa-3,4,17,22-tetrazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,18(22),19-hexaene |
|---|---|
| PubChem CID | 175741258 |
| Molecular Formula | C26H23F6N5O5 |
| Molecular Weight | 599.49 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | (12R)-21-nitro-6-phenylmethoxy-6,19-bis(trifluoromethyl)-14,23-dioxa-3,4,17,22-tetrazatetracyclo[16.3.1.12,5.012,17]tricosa-1(21),2,4,9,18(22),19-hexaene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)CCC=CC[C@@H]1COCCN21 |
| InChI | InChI=1S/C26H23F6N5O5/c27-25(28,29)18-13-19(37(38)39)20-22-34-35-23(42-22)24(26(30,31)32,41-14-16-7-3-1-4-8-16)10-6-2-5-9-17-15-40-12-11-36(17)21(18)33-20/h1-5,7-8,13,17H,6,9-12,14-15H2/t17-,24?/m1/s1 |
| InChIKey | LHOWAFMYTRDKHN-BPNWFJGMSA-N |
| XLogP | 5.98 |
| TPSA | 116.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|