About 4,4-difluoroazepine;hydrate
4,4-difluoroazepine;hydrate (PubChem CID 175741792) has the molecular formula C6H7F2NO
and a molecular weight of 147.12 g/mol. Its IUPAC name is 4,4-difluoroazepine;hydrate.
Molecular Properties
| Compound Name | 4,4-difluoroazepine;hydrate |
| PubChem CID | 175741792 |
| Molecular Formula | C6H7F2NO |
| Molecular Weight | 147.12 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 4,4-difluoroazepine;hydrate |
| SMILES | FC1(F)C=CC=NC=C1.O |
| InChI | InChI=1S/C6H5F2N.H2O/c7-6(8)2-1-4-9-5-3-6;/h1-5H;1H2 |
| InChIKey | YLSCVDPVXZBGQN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.12 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-difluoroazepine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoroazepine;hydrate?
The IUPAC name of 4,4-difluoroazepine;hydrate (CID 175741792) is 4,4-difluoroazepine;hydrate.
What is the SMILES notation for 4,4-difluoroazepine;hydrate?
The canonical SMILES for 4,4-difluoroazepine;hydrate is FC1(F)C=CC=NC=C1.O.
What is the InChIKey of 4,4-difluoroazepine;hydrate?
The InChIKey is YLSCVDPVXZBGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2N.H2O/c7-6(8)2-1-4-9-5-3-6;/h1-5H;1H2.
What are the key properties of 4,4-difluoroazepine;hydrate?
4,4-difluoroazepine;hydrate has a molecular weight of 147.12 g/mol, XLogP of 0.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoroazepine;hydrate is sourced from PubChem (CID 175741792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).