C30H47N7O7 — CID 175742008
2-[[(2S)-2-[[(2S)-1-[2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetic acid (PubChem CID 175742008) has the molecular formula C30H47N7O7 and a molecular weight of 617.75 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-1-[2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-1-[2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 175742008 |
| Molecular Formula | C30H47N7O7 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-1-[2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C30H47N7O7/c1-19(2)15-23(29(43)34-18-26(39)40)36-30(44)24-12-8-14-37(24)25(38)17-33-28(42)22(11-6-7-13-31)35-27(41)21(32)16-20-9-4-3-5-10-20/h3-5,9-10,19,21-24H,6-8,11-18,31-32H2,1-2H3,(H,33,42)(H,34,43)(H,35,41)(H,36,44)(H,39,40)/t21-,22-,23-,24-/m0/s1 |
| InChIKey | XKVPQRWIFFAHDI-ZJZGAYNASA-N |
| XLogP | -0.99 |
| TPSA | 226.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|