About ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde
ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde (PubChem CID 175742529) has the molecular formula C11H16F3NO3
and a molecular weight of 267.25 g/mol. Its IUPAC name is ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde.
Molecular Properties
| Compound Name | ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde |
| PubChem CID | 175742529 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde |
| SMILES | CCOC(=O)C=C1CCNCC1.O=CC(F)(F)F |
| InChI | InChI=1S/C9H15NO2.C2HF3O/c1-2-12-9(11)7-8-3-5-10-6-4-8;3-2(4,5)1-6/h7,10H,2-6H2,1H3;1H |
| InChIKey | ZXCVQXGDSGMDKB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde?
The IUPAC name of ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde (CID 175742529) is ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde.
What is the SMILES notation for ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde?
The canonical SMILES for ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde is CCOC(=O)C=C1CCNCC1.O=CC(F)(F)F.
What is the InChIKey of ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde?
The InChIKey is ZXCVQXGDSGMDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.C2HF3O/c1-2-12-9(11)7-8-3-5-10-6-4-8;3-2(4,5)1-6/h7,10H,2-6H2,1H3;1H.
What are the key properties of ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde?
ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde has a molecular weight of 267.25 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-piperidin-4-ylideneacetate;2,2,2-trifluoroacetaldehyde is sourced from PubChem (CID 175742529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).