C5H9ClN4O — CID 175742670
5-(methylamino)-1H-pyrazole-4-carboxamide;hydrochloride (PubChem CID 175742670) has the molecular formula C5H9ClN4O and a molecular weight of 176.61 g/mol. Its IUPAC name is 5-(methylamino)-1H-pyrazole-4-carboxamide;hydrochloride.
| Compound Name | 5-(methylamino)-1H-pyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 175742670 |
| Molecular Formula | C5H9ClN4O |
| Molecular Weight | 176.61 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 5-(methylamino)-1H-pyrazole-4-carboxamide;hydrochloride |
| SMILES | CNc1[nH]ncc1C(N)=O.Cl |
| InChI | InChI=1S/C5H8N4O.ClH/c1-7-5-3(4(6)10)2-8-9-5;/h2H,1H3,(H2,6,10)(H2,7,8,9);1H |
| InChIKey | AAIWSDYNZWYEJY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.61 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |