C19H22FN3OSSi — CID 175742918
4-(1,1-dimethylsilinan-4-yl)-2-(2-fluorophenyl)pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 175742918) has the molecular formula C19H22FN3OSSi and a molecular weight of 387.56 g/mol. Its IUPAC name is 4-(1,1-dimethylsilinan-4-yl)-2-(2-fluorophenyl)pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 4-(1,1-dimethylsilinan-4-yl)-2-(2-fluorophenyl)pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 175742918 |
| Molecular Formula | C19H22FN3OSSi |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-(1,1-dimethylsilinan-4-yl)-2-(2-fluorophenyl)pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | C[Si]1(C)CCC(n2c(C(N)=O)cc3sc(-c4ccccc4F)nc32)CC1 |
| InChI | InChI=1S/C19H22FN3OSSi/c1-26(2)9-7-12(8-10-26)23-15(17(21)24)11-16-18(23)22-19(25-16)13-5-3-4-6-14(13)20/h3-6,11-12H,7-10H2,1-2H3,(H2,21,24) |
| InChIKey | PVAUUVYHEYUQRF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|