About 1-(cyclopropylmethyl)-2,5-dihydrotetrazole
1-(cyclopropylmethyl)-2,5-dihydrotetrazole (PubChem CID 175743164) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2,5-dihydrotetrazole.
Molecular Properties
| Compound Name | 1-(cyclopropylmethyl)-2,5-dihydrotetrazole |
| PubChem CID | 175743164 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 1-(cyclopropylmethyl)-2,5-dihydrotetrazole |
| SMILES | C1CC1CN1CN=NN1 |
| InChI | InChI=1S/C5H10N4/c1-2-5(1)3-9-4-6-7-8-9/h5H,1-4H2,(H,6,8) |
| InChIKey | FVOHFINCMBOBRT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(cyclopropylmethyl)-2,5-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-2,5-dihydrotetrazole?
The IUPAC name of 1-(cyclopropylmethyl)-2,5-dihydrotetrazole (CID 175743164) is 1-(cyclopropylmethyl)-2,5-dihydrotetrazole.
What is the SMILES notation for 1-(cyclopropylmethyl)-2,5-dihydrotetrazole?
The canonical SMILES for 1-(cyclopropylmethyl)-2,5-dihydrotetrazole is C1CC1CN1CN=NN1.
What is the InChIKey of 1-(cyclopropylmethyl)-2,5-dihydrotetrazole?
The InChIKey is FVOHFINCMBOBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4/c1-2-5(1)3-9-4-6-7-8-9/h5H,1-4H2,(H,6,8).
What are the key properties of 1-(cyclopropylmethyl)-2,5-dihydrotetrazole?
1-(cyclopropylmethyl)-2,5-dihydrotetrazole has a molecular weight of 126.16 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-2,5-dihydrotetrazole is sourced from PubChem (CID 175743164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).