About 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver
1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver (PubChem CID 175743302) has the molecular formula C19H22AgN2
and a molecular weight of 386.27 g/mol. Its IUPAC name is 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver.
Molecular Properties
| Compound Name | 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver |
| PubChem CID | 175743302 |
| Molecular Formula | C19H22AgN2 |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver |
| SMILES | Cc1cccc(C)c1N1C=CN(c2c(C)cccc2C)C1.[Ag] |
| InChI | InChI=1S/C19H22N2.Ag/c1-14-7-5-8-15(2)18(14)20-11-12-21(13-20)19-16(3)9-6-10-17(19)4;/h5-12H,13H2,1-4H3; |
| InChIKey | OCTRIMCAOJRLNC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver?
The IUPAC name of 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver (CID 175743302) is 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver.
What is the SMILES notation for 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver?
The canonical SMILES for 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver is Cc1cccc(C)c1N1C=CN(c2c(C)cccc2C)C1.[Ag].
What is the InChIKey of 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver?
The InChIKey is OCTRIMCAOJRLNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2.Ag/c1-14-7-5-8-15(2)18(14)20-11-12-21(13-20)19-16(3)9-6-10-17(19)4;/h5-12H,13H2,1-4H3;.
What are the key properties of 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver?
1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver has a molecular weight of 386.27 g/mol, XLogP of 4.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2,6-dimethylphenyl)-2H-imidazole;silver is sourced from PubChem (CID 175743302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).