C31H30F6N6O5 — CID 175745146
2-[2-[[4,4-difluoro-3-(phenylmethoxycarbonylamino)cyclohexyl]methyl]imidazo[1,2-b]pyridazin-7-yl]-4-(3,3,4,4-tetrafluoropyrrolidine-1-carbonyl)-2,5-dihydropyrrole-1-carboxylic acid (PubChem CID 175745146) has the molecular formula C31H30F6N6O5 and a molecular weight of 680.61 g/mol. Its IUPAC name is 2-[2-[[4,4-difluoro-3-(phenylmethoxycarbonylamino)cyclohexyl]methyl]imidazo[1,2-b]pyridazin-7-yl]-4-(3,3,4,4-tetrafluoropyrrolidine-1-carbonyl)-2,5-dihydropyrrole-1-carboxylic acid.
| Compound Name | 2-[2-[[4,4-difluoro-3-(phenylmethoxycarbonylamino)cyclohexyl]methyl]imidazo[1,2-b]pyridazin-7-yl]-4-(3,3,4,4-tetrafluoropyrrolidine-1-carbonyl)-2,5-dihydropyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 175745146 |
| Molecular Formula | C31H30F6N6O5 |
| Molecular Weight | 680.61 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | 2-[2-[[4,4-difluoro-3-(phenylmethoxycarbonylamino)cyclohexyl]methyl]imidazo[1,2-b]pyridazin-7-yl]-4-(3,3,4,4-tetrafluoropyrrolidine-1-carbonyl)-2,5-dihydropyrrole-1-carboxylic acid |
| SMILES | O=C(NC1CC(Cc2cn3ncc(C4C=C(C(=O)N5CC(F)(F)C(F)(F)C5)CN4C(=O)O)cc3n2)CCC1(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C31H30F6N6O5/c32-29(33)7-6-19(9-24(29)40-27(45)48-15-18-4-2-1-3-5-18)8-22-14-43-25(39-22)11-20(12-38-43)23-10-21(13-42(23)28(46)47)26(44)41-16-30(34,35)31(36,37)17-41/h1-5,10-12,14,19,23-24H,6-9,13,15-17H2,(H,40,45)(H,46,47) |
| InChIKey | XZRQXHBXORCLSW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|