C6H4Cl8O — CID 175745759
2,3,4,5,6-pentachlorophenol;trihydrochloride (PubChem CID 175745759) has the molecular formula C6H4Cl8O and a molecular weight of 375.72 g/mol. Its IUPAC name is 2,3,4,5,6-pentachlorophenol;trihydrochloride.
| Compound Name | 2,3,4,5,6-pentachlorophenol;trihydrochloride |
|---|---|
| PubChem CID | 175745759 |
| Molecular Formula | C6H4Cl8O |
| Molecular Weight | 375.72 g/mol |
| Exact Mass | 371.78 |
| IUPAC Name | 2,3,4,5,6-pentachlorophenol;trihydrochloride |
| SMILES | Cl.Cl.Cl.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl5O.3ClH/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;/h12H;3*1H |
| InChIKey | JQILLKZANGJOLC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.72 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|