C22H20Cl4N2O4 — CID 175745954
diethyl (5R)-4,4-bis(2,4-dichlorophenyl)-5-methyl-1H-pyrazole-3,5-dicarboxylate (PubChem CID 175745954) has the molecular formula C22H20Cl4N2O4 and a molecular weight of 518.22 g/mol. Its IUPAC name is diethyl (5R)-4,4-bis(2,4-dichlorophenyl)-5-methyl-1H-pyrazole-3,5-dicarboxylate.
| Compound Name | diethyl (5R)-4,4-bis(2,4-dichlorophenyl)-5-methyl-1H-pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 175745954 |
| Molecular Formula | C22H20Cl4N2O4 |
| Molecular Weight | 518.22 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | diethyl (5R)-4,4-bis(2,4-dichlorophenyl)-5-methyl-1H-pyrazole-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=NN[C@@](C)(C(=O)OCC)C1(c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H20Cl4N2O4/c1-4-31-19(29)18-22(14-8-6-12(23)10-16(14)25,15-9-7-13(24)11-17(15)26)21(3,28-27-18)20(30)32-5-2/h6-11,28H,4-5H2,1-3H3/t21-/m0/s1 |
| InChIKey | FVSDCOHZCAXAII-NRFANRHFSA-N |
| XLogP | 5.43 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.22 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |