About 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine
4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine (PubChem CID 175746418) has the molecular formula C14H16ClFN2
and a molecular weight of 266.75 g/mol. Its IUPAC name is 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine |
| PubChem CID | 175746418 |
| Molecular Formula | C14H16ClFN2 |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine |
| SMILES | CC(C)C1C(c2cc(Cl)ncn2)=CC(F)=CC1C |
| InChI | InChI=1S/C14H16ClFN2/c1-8(2)14-9(3)4-10(16)5-11(14)12-6-13(15)18-7-17-12/h4-9,14H,1-3H3 |
| InChIKey | NRQWOQJSJZBCFY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine?
The IUPAC name of 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine (CID 175746418) is 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine.
What is the SMILES notation for 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine?
The canonical SMILES for 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine is CC(C)C1C(c2cc(Cl)ncn2)=CC(F)=CC1C.
What is the InChIKey of 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine?
The InChIKey is NRQWOQJSJZBCFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClFN2/c1-8(2)14-9(3)4-10(16)5-11(14)12-6-13(15)18-7-17-12/h4-9,14H,1-3H3.
What are the key properties of 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine?
4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine has a molecular weight of 266.75 g/mol, XLogP of 4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(3-fluoro-5-methyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrimidine is sourced from PubChem (CID 175746418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).